C31H47NO2 — CID 142834161
(2E,4Z,5E,7E,9Z)-4-[(Z)-1-ethoxybut-2-enylidene]-N-[(Z,2R,3E)-3-ethylidenehept-5-en-2-yl]-8-methoxy-5-methylundeca-2,5,7,9-tetraen-1-amine;prop-1-yne (PubChem CID 142834161) has the molecular formula C31H47NO2 and a molecular weight of 465.72 g/mol. Its IUPAC name is (2E,4Z,5E,7E,9Z)-4-[(Z)-1-ethoxybut-2-enylidene]-N-[(Z,2R,3E)-3-ethylidenehept-5-en-2-yl]-8-methoxy-5-methylundeca-2,5,7,9-tetraen-1-amine;prop-1-yne.
| Compound Name | (2E,4Z,5E,7E,9Z)-4-[(Z)-1-ethoxybut-2-enylidene]-N-[(Z,2R,3E)-3-ethylidenehept-5-en-2-yl]-8-methoxy-5-methylundeca-2,5,7,9-tetraen-1-amine;prop-1-yne |
|---|---|
| PubChem CID | 142834161 |
| Molecular Formula | C31H47NO2 |
| Molecular Weight | 465.72 g/mol |
| Exact Mass | 465.36 |
| IUPAC Name | (2E,4Z,5E,7E,9Z)-4-[(Z)-1-ethoxybut-2-enylidene]-N-[(Z,2R,3E)-3-ethylidenehept-5-en-2-yl]-8-methoxy-5-methylundeca-2,5,7,9-tetraen-1-amine;prop-1-yne |
| SMILES | C#CC.C/C=C\C/C(=C\C)[C@@H](C)NC/C=C/C(=C(\C=C/C)OCC)/C(C)=C/C=C(\C=C/C)OC |
| InChI | InChI=1S/C28H43NO2.C3H4/c1-9-14-18-25(12-4)24(7)29-22-15-19-27(28(17-11-3)31-13-5)23(6)20-21-26(30-8)16-10-2;1-3-2/h9-12,14-17,19-21,24,29H,13,18,22H2,1-8H3;1H,2H3/b14-9-,16-10-,17-11-,19-15+,23-20+,25-12+,26-21+,28-27-;/t24-;/m1./s1 |
| InChIKey | NLOOLBGEHQIIOZ-DAYQRQJESA-N |
| XLogP | 7.99 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.72 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|