C26H23FN2O3 — CID 142834990
5-[2-[2-[(4-fluorophenyl)methoxy]-5-hydroxyphenyl]-5-methylpyrrol-1-yl]-2-methylbenzamide (PubChem CID 142834990) has the molecular formula C26H23FN2O3 and a molecular weight of 430.48 g/mol. Its IUPAC name is 5-[2-[2-[(4-fluorophenyl)methoxy]-5-hydroxyphenyl]-5-methylpyrrol-1-yl]-2-methylbenzamide.
| Compound Name | 5-[2-[2-[(4-fluorophenyl)methoxy]-5-hydroxyphenyl]-5-methylpyrrol-1-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 142834990 |
| Molecular Formula | C26H23FN2O3 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 5-[2-[2-[(4-fluorophenyl)methoxy]-5-hydroxyphenyl]-5-methylpyrrol-1-yl]-2-methylbenzamide |
| SMILES | Cc1ccc(-n2c(C)ccc2-c2cc(O)ccc2OCc2ccc(F)cc2)cc1C(N)=O |
| InChI | InChI=1S/C26H23FN2O3/c1-16-3-9-20(13-22(16)26(28)31)29-17(2)4-11-24(29)23-14-21(30)10-12-25(23)32-15-18-5-7-19(27)8-6-18/h3-14,30H,15H2,1-2H3,(H2,28,31) |
| InChIKey | DLIFWAOGXIZESY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|