C17H21N — CID 142835497
2-ethenyl-N-methyl-N-[(2Z,4Z)-octa-2,4,7-trienyl]aniline (PubChem CID 142835497) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is 2-ethenyl-N-methyl-N-[(2Z,4Z)-octa-2,4,7-trienyl]aniline.
| Compound Name | 2-ethenyl-N-methyl-N-[(2Z,4Z)-octa-2,4,7-trienyl]aniline |
|---|---|
| PubChem CID | 142835497 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 2-ethenyl-N-methyl-N-[(2Z,4Z)-octa-2,4,7-trienyl]aniline |
| SMILES | C=CC/C=C\C=C/CN(C)c1ccccc1C=C |
| InChI | InChI=1S/C17H21N/c1-4-6-7-8-9-12-15-18(3)17-14-11-10-13-16(17)5-2/h4-5,7-14H,1-2,6,15H2,3H3/b8-7-,12-9- |
| InChIKey | LXTRSXBNJFRXDL-JNWHFCKMSA-N |
| XLogP | 4.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|