C22H17F2N5S — CID 142836210
5-fluoro-2-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-4-[5-(thiophen-2-ylmethyl)-1H-1,2,4-triazol-3-yl]aniline (PubChem CID 142836210) has the molecular formula C22H17F2N5S and a molecular weight of 421.48 g/mol. Its IUPAC name is 5-fluoro-2-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-4-[5-(thiophen-2-ylmethyl)-1H-1,2,4-triazol-3-yl]aniline.
| Compound Name | 5-fluoro-2-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-4-[5-(thiophen-2-ylmethyl)-1H-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 142836210 |
| Molecular Formula | C22H17F2N5S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 5-fluoro-2-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-4-[5-(thiophen-2-ylmethyl)-1H-1,2,4-triazol-3-yl]aniline |
| SMILES | [H]/N=C(\C=C\c1ccc(F)cc1)c1cc(-c2n[nH]c(Cc3cccs3)n2)c(F)cc1N |
| InChI | InChI=1S/C22H17F2N5S/c23-14-6-3-13(4-7-14)5-8-19(25)17-11-16(18(24)12-20(17)26)22-27-21(28-29-22)10-15-2-1-9-30-15/h1-9,11-12,25H,10,26H2,(H,27,28,29)/b8-5+,25-19+ |
| InChIKey | ADZGEUUCCVGASU-PNJQKHSVSA-N |
| XLogP | 5.07 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|