About 3-(benzenecarboximidoyl)-5-ethenylpyridin-2-amine;1-cyclopentyl-N-methylmethanamine
3-(benzenecarboximidoyl)-5-ethenylpyridin-2-amine;1-cyclopentyl-N-methylmethanamine (PubChem CID 142836541) has the molecular formula C21H28N4
and a molecular weight of 336.48 g/mol. Its IUPAC name is 3-(benzenecarboximidoyl)-5-ethenylpyridin-2-amine;1-cyclopentyl-N-methylmethanamine.
Molecular Properties
| Compound Name | 3-(benzenecarboximidoyl)-5-ethenylpyridin-2-amine;1-cyclopentyl-N-methylmethanamine |
| PubChem CID | 142836541 |
| Molecular Formula | C21H28N4 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 3-(benzenecarboximidoyl)-5-ethenylpyridin-2-amine;1-cyclopentyl-N-methylmethanamine |
| SMILES | CNCC1CCCC1.[H]/N=C(\c1ccccc1)c1cc(C=C)cnc1N |
| InChI | InChI=1S/C14H13N3.C7H15N/c1-2-10-8-12(14(16)17-9-10)13(15)11-6-4-3-5-7-11;1-8-6-7-4-2-3-5-7/h2-9,15H,1H2,(H2,16,17);7-8H,2-6H2,1H3/b15-13+; |
| InChIKey | DJMDKCUWIAUQDV-GVYCEHEKSA-N |
| XLogP | 4.12 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(benzenecarboximidoyl)-5-ethenylpyridin-2-amine;1-cyclopentyl-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenecarboximidoyl)-5-ethenylpyridin-2-amine;1-cyclopentyl-N-methylmethanamine?
The IUPAC name of 3-(benzenecarboximidoyl)-5-ethenylpyridin-2-amine;1-cyclopentyl-N-methylmethanamine (CID 142836541) is 3-(benzenecarboximidoyl)-5-ethenylpyridin-2-amine;1-cyclopentyl-N-methylmethanamine.
What is the SMILES notation for 3-(benzenecarboximidoyl)-5-ethenylpyridin-2-amine;1-cyclopentyl-N-methylmethanamine?
The canonical SMILES for 3-(benzenecarboximidoyl)-5-ethenylpyridin-2-amine;1-cyclopentyl-N-methylmethanamine is CNCC1CCCC1.[H]/N=C(\c1ccccc1)c1cc(C=C)cnc1N.
What is the InChIKey of 3-(benzenecarboximidoyl)-5-ethenylpyridin-2-amine;1-cyclopentyl-N-methylmethanamine?
The InChIKey is DJMDKCUWIAUQDV-GVYCEHEKSA-N. The full InChI is InChI=1S/C14H13N3.C7H15N/c1-2-10-8-12(14(16)17-9-10)13(15)11-6-4-3-5-7-11;1-8-6-7-4-2-3-5-7/h2-9,15H,1H2,(H2,16,17);7-8H,2-6H2,1H3/b15-13+;.
What are the key properties of 3-(benzenecarboximidoyl)-5-ethenylpyridin-2-amine;1-cyclopentyl-N-methylmethanamine?
3-(benzenecarboximidoyl)-5-ethenylpyridin-2-amine;1-cyclopentyl-N-methylmethanamine has a molecular weight of 336.48 g/mol, XLogP of 4.12, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenecarboximidoyl)-5-ethenylpyridin-2-amine;1-cyclopentyl-N-methylmethanamine is sourced from PubChem (CID 142836541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).