C12H28N4O6 — CID 142836643
5-amino-2-(aminomethyl)-6-(3,5-diamino-6,6-dihydroxyhexan-2-yl)oxyoxane-3,4-diol (PubChem CID 142836643) has the molecular formula C12H28N4O6 and a molecular weight of 324.38 g/mol. Its IUPAC name is 5-amino-2-(aminomethyl)-6-(3,5-diamino-6,6-dihydroxyhexan-2-yl)oxyoxane-3,4-diol.
| Compound Name | 5-amino-2-(aminomethyl)-6-(3,5-diamino-6,6-dihydroxyhexan-2-yl)oxyoxane-3,4-diol |
|---|---|
| PubChem CID | 142836643 |
| Molecular Formula | C12H28N4O6 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 5-amino-2-(aminomethyl)-6-(3,5-diamino-6,6-dihydroxyhexan-2-yl)oxyoxane-3,4-diol |
| SMILES | CC(OC1OC(CN)C(O)C(O)C1N)C(N)CC(N)C(O)O |
| InChI | InChI=1S/C12H28N4O6/c1-4(5(14)2-6(15)11(19)20)21-12-8(16)10(18)9(17)7(3-13)22-12/h4-12,17-20H,2-3,13-16H2,1H3 |
| InChIKey | HZWBFRDBLKDCDQ-UHFFFAOYSA-N |
| XLogP | -4.52 |
| TPSA | 203.46 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | -4.52 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|