ethane;2-(methanesulfinamido)acetic acid

C5H13NO3S — CID 142836811

IUPACethane;2-(methanesulfinamido)acetic acid
SMILESCC.CS(=O)NCC(=O)O
InChIInChI=1S/C3H7NO3S.C2H6/c1-8(7)4-2-3(5)6;1-2/h4H,2H2,1H3,(H,5,6);1-2H3
InChIKeyPSAVJRDFIALFOT-UHFFFAOYSA-N
MW167.23 g/mol
LogP-0.02
Rot. Bonds3

About ethane;2-(methanesulfinamido)acetic acid

ethane;2-(methanesulfinamido)acetic acid (PubChem CID 142836811) has the molecular formula C5H13NO3S and a molecular weight of 167.23 g/mol. Its IUPAC name is ethane;2-(methanesulfinamido)acetic acid.

Molecular Properties

Compound Nameethane;2-(methanesulfinamido)acetic acid
PubChem CID142836811
Molecular FormulaC5H13NO3S
Molecular Weight167.23 g/mol
Exact Mass167.06
IUPAC Nameethane;2-(methanesulfinamido)acetic acid
SMILESCC.CS(=O)NCC(=O)O
InChIInChI=1S/C3H7NO3S.C2H6/c1-8(7)4-2-3(5)6;1-2/h4H,2H2,1H3,(H,5,6);1-2H3
InChIKeyPSAVJRDFIALFOT-UHFFFAOYSA-N
XLogP-0.02
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500167.23
LogP ≤ 5-0.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze ethane;2-(methanesulfinamido)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;2-(methanesulfinamido)acetic acid?
The IUPAC name of ethane;2-(methanesulfinamido)acetic acid (CID 142836811) is ethane;2-(methanesulfinamido)acetic acid.
What is the SMILES notation for ethane;2-(methanesulfinamido)acetic acid?
The canonical SMILES for ethane;2-(methanesulfinamido)acetic acid is CC.CS(=O)NCC(=O)O.
What is the InChIKey of ethane;2-(methanesulfinamido)acetic acid?
The InChIKey is PSAVJRDFIALFOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO3S.C2H6/c1-8(7)4-2-3(5)6;1-2/h4H,2H2,1H3,(H,5,6);1-2H3.
What are the key properties of ethane;2-(methanesulfinamido)acetic acid?
ethane;2-(methanesulfinamido)acetic acid has a molecular weight of 167.23 g/mol, XLogP of -0.02, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(methanesulfinamido)acetic acid is sourced from PubChem (CID 142836811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).