C10H20N2O3 — CID 142836832
ethane;5-ethyl-1,3-diazinane-2,4,6-trione (PubChem CID 142836832) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is ethane;5-ethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | ethane;5-ethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 142836832 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | ethane;5-ethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC.CC.CCC1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C6H8N2O3.2C2H6/c1-2-3-4(9)7-6(11)8-5(3)10;2*1-2/h3H,2H2,1H3,(H2,7,8,9,10,11);2*1-2H3 |
| InChIKey | AIFUMHMCCSVJSY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|