C24H40N2O2 — CID 142836852
3-[(3R,4R)-1-(3-hydroxydecyl)-3,4-dimethylpiperidin-4-yl]benzamide (PubChem CID 142836852) has the molecular formula C24H40N2O2 and a molecular weight of 388.60 g/mol. Its IUPAC name is 3-[(3R,4R)-1-(3-hydroxydecyl)-3,4-dimethylpiperidin-4-yl]benzamide.
| Compound Name | 3-[(3R,4R)-1-(3-hydroxydecyl)-3,4-dimethylpiperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 142836852 |
| Molecular Formula | C24H40N2O2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.31 |
| IUPAC Name | 3-[(3R,4R)-1-(3-hydroxydecyl)-3,4-dimethylpiperidin-4-yl]benzamide |
| SMILES | CCCCCCCC(O)CCN1CC[C@@](C)(c2cccc(C(N)=O)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C24H40N2O2/c1-4-5-6-7-8-12-22(27)13-15-26-16-14-24(3,19(2)18-26)21-11-9-10-20(17-21)23(25)28/h9-11,17,19,22,27H,4-8,12-16,18H2,1-3H3,(H2,25,28)/t19-,22?,24+/m0/s1 |
| InChIKey | CKJQXUVZLYBBSB-ITPZNCDISA-N |
| XLogP | 4.50 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|