About N-[(2E)-2-[(Z)-3-(trifluoromethoxy)prop-1-enyl]penta-2,4-dienyl]formamide
N-[(2E)-2-[(Z)-3-(trifluoromethoxy)prop-1-enyl]penta-2,4-dienyl]formamide (PubChem CID 142837212) has the molecular formula C10H12F3NO2
and a molecular weight of 235.20 g/mol. Its IUPAC name is N-[(2E)-2-[(Z)-3-(trifluoromethoxy)prop-1-enyl]penta-2,4-dienyl]formamide.
Molecular Properties
| Compound Name | N-[(2E)-2-[(Z)-3-(trifluoromethoxy)prop-1-enyl]penta-2,4-dienyl]formamide |
| PubChem CID | 142837212 |
| Molecular Formula | C10H12F3NO2 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | N-[(2E)-2-[(Z)-3-(trifluoromethoxy)prop-1-enyl]penta-2,4-dienyl]formamide |
| SMILES | C=C/C=C(\C=C/COC(F)(F)F)CNC=O |
| InChI | InChI=1S/C10H12F3NO2/c1-2-4-9(7-14-8-15)5-3-6-16-10(11,12)13/h2-5,8H,1,6-7H2,(H,14,15)/b5-3-,9-4+ |
| InChIKey | JXJPBZOUFROYTL-LWUTYWFWSA-N |
| XLogP | 1.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E)-2-[(Z)-3-(trifluoromethoxy)prop-1-enyl]penta-2,4-dienyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E)-2-[(Z)-3-(trifluoromethoxy)prop-1-enyl]penta-2,4-dienyl]formamide?
The IUPAC name of N-[(2E)-2-[(Z)-3-(trifluoromethoxy)prop-1-enyl]penta-2,4-dienyl]formamide (CID 142837212) is N-[(2E)-2-[(Z)-3-(trifluoromethoxy)prop-1-enyl]penta-2,4-dienyl]formamide.
What is the SMILES notation for N-[(2E)-2-[(Z)-3-(trifluoromethoxy)prop-1-enyl]penta-2,4-dienyl]formamide?
The canonical SMILES for N-[(2E)-2-[(Z)-3-(trifluoromethoxy)prop-1-enyl]penta-2,4-dienyl]formamide is C=C/C=C(\C=C/COC(F)(F)F)CNC=O.
What is the InChIKey of N-[(2E)-2-[(Z)-3-(trifluoromethoxy)prop-1-enyl]penta-2,4-dienyl]formamide?
The InChIKey is JXJPBZOUFROYTL-LWUTYWFWSA-N. The full InChI is InChI=1S/C10H12F3NO2/c1-2-4-9(7-14-8-15)5-3-6-16-10(11,12)13/h2-5,8H,1,6-7H2,(H,14,15)/b5-3-,9-4+.
What are the key properties of N-[(2E)-2-[(Z)-3-(trifluoromethoxy)prop-1-enyl]penta-2,4-dienyl]formamide?
N-[(2E)-2-[(Z)-3-(trifluoromethoxy)prop-1-enyl]penta-2,4-dienyl]formamide has a molecular weight of 235.20 g/mol, XLogP of 1.94, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E)-2-[(Z)-3-(trifluoromethoxy)prop-1-enyl]penta-2,4-dienyl]formamide is sourced from PubChem (CID 142837212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).