C19H33NO2 — CID 142837750
N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)cyclohexanamine;ethane (PubChem CID 142837750) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)cyclohexanamine;ethane.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)cyclohexanamine;ethane |
|---|---|
| PubChem CID | 142837750 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)cyclohexanamine;ethane |
| SMILES | CC.CC.c1cc2c(cc1CNC1CCCCC1)OCCO2 |
| InChI | InChI=1S/C15H21NO2.2C2H6/c1-2-4-13(5-3-1)16-11-12-6-7-14-15(10-12)18-9-8-17-14;2*1-2/h6-7,10,13,16H,1-5,8-9,11H2;2*1-2H3 |
| InChIKey | VLYXCNKJOIOJTH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |