About 7-cycloheptyl-6-(4-phenylphenyl)-3-(2H-tetrazol-5-yl)pyrazolo[1,5-a]pyrimidine
7-cycloheptyl-6-(4-phenylphenyl)-3-(2H-tetrazol-5-yl)pyrazolo[1,5-a]pyrimidine (PubChem CID 142838320) has the molecular formula C26H25N7
and a molecular weight of 435.54 g/mol. Its IUPAC name is 7-cycloheptyl-6-(4-phenylphenyl)-3-(2H-tetrazol-5-yl)pyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 7-cycloheptyl-6-(4-phenylphenyl)-3-(2H-tetrazol-5-yl)pyrazolo[1,5-a]pyrimidine |
| PubChem CID | 142838320 |
| Molecular Formula | C26H25N7 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 7-cycloheptyl-6-(4-phenylphenyl)-3-(2H-tetrazol-5-yl)pyrazolo[1,5-a]pyrimidine |
| SMILES | c1ccc(-c2ccc(-c3cnc4c(-c5nn[nH]n5)cnn4c3C3CCCCCC3)cc2)cc1 |
| InChI | InChI=1S/C26H25N7/c1-2-5-11-21(10-4-1)24-22(20-14-12-19(13-15-20)18-8-6-3-7-9-18)16-27-26-23(17-28-33(24)26)25-29-31-32-30-25/h3,6-9,12-17,21H,1-2,4-5,10-11H2,(H,29,30,31,32) |
| InChIKey | JHNGEAZMDODEJC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-cycloheptyl-6-(4-phenylphenyl)-3-(2H-tetrazol-5-yl)pyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cycloheptyl-6-(4-phenylphenyl)-3-(2H-tetrazol-5-yl)pyrazolo[1,5-a]pyrimidine?
The IUPAC name of 7-cycloheptyl-6-(4-phenylphenyl)-3-(2H-tetrazol-5-yl)pyrazolo[1,5-a]pyrimidine (CID 142838320) is 7-cycloheptyl-6-(4-phenylphenyl)-3-(2H-tetrazol-5-yl)pyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 7-cycloheptyl-6-(4-phenylphenyl)-3-(2H-tetrazol-5-yl)pyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 7-cycloheptyl-6-(4-phenylphenyl)-3-(2H-tetrazol-5-yl)pyrazolo[1,5-a]pyrimidine is c1ccc(-c2ccc(-c3cnc4c(-c5nn[nH]n5)cnn4c3C3CCCCCC3)cc2)cc1.
What is the InChIKey of 7-cycloheptyl-6-(4-phenylphenyl)-3-(2H-tetrazol-5-yl)pyrazolo[1,5-a]pyrimidine?
The InChIKey is JHNGEAZMDODEJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25N7/c1-2-5-11-21(10-4-1)24-22(20-14-12-19(13-15-20)18-8-6-3-7-9-18)16-27-26-23(17-28-33(24)26)25-29-31-32-30-25/h3,6-9,12-17,21H,1-2,4-5,10-11H2,(H,29,30,31,32).
What are the key properties of 7-cycloheptyl-6-(4-phenylphenyl)-3-(2H-tetrazol-5-yl)pyrazolo[1,5-a]pyrimidine?
7-cycloheptyl-6-(4-phenylphenyl)-3-(2H-tetrazol-5-yl)pyrazolo[1,5-a]pyrimidine has a molecular weight of 435.54 g/mol, XLogP of 5.68, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cycloheptyl-6-(4-phenylphenyl)-3-(2H-tetrazol-5-yl)pyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 142838320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).