About but-1-ene;3-ethenyl-N-methylpyridin-2-amine;prop-2-ene-1-thiol
but-1-ene;3-ethenyl-N-methylpyridin-2-amine;prop-2-ene-1-thiol (PubChem CID 142838359) has the molecular formula C15H24N2S
and a molecular weight of 264.44 g/mol. Its IUPAC name is but-1-ene;3-ethenyl-N-methylpyridin-2-amine;prop-2-ene-1-thiol.
Molecular Properties
| Compound Name | but-1-ene;3-ethenyl-N-methylpyridin-2-amine;prop-2-ene-1-thiol |
| PubChem CID | 142838359 |
| Molecular Formula | C15H24N2S |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | but-1-ene;3-ethenyl-N-methylpyridin-2-amine;prop-2-ene-1-thiol |
| SMILES | C=CCC.C=CCS.C=Cc1cccnc1NC |
| InChI | InChI=1S/C8H10N2.C4H8.C3H6S/c1-3-7-5-4-6-10-8(7)9-2;1-3-4-2;1-2-3-4/h3-6H,1H2,2H3,(H,9,10);3H,1,4H2,2H3;2,4H,1,3H2 |
| InChIKey | SZZYLMWJTPSFCC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;3-ethenyl-N-methylpyridin-2-amine;prop-2-ene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;3-ethenyl-N-methylpyridin-2-amine;prop-2-ene-1-thiol?
The IUPAC name of but-1-ene;3-ethenyl-N-methylpyridin-2-amine;prop-2-ene-1-thiol (CID 142838359) is but-1-ene;3-ethenyl-N-methylpyridin-2-amine;prop-2-ene-1-thiol.
What is the SMILES notation for but-1-ene;3-ethenyl-N-methylpyridin-2-amine;prop-2-ene-1-thiol?
The canonical SMILES for but-1-ene;3-ethenyl-N-methylpyridin-2-amine;prop-2-ene-1-thiol is C=CCC.C=CCS.C=Cc1cccnc1NC.
What is the InChIKey of but-1-ene;3-ethenyl-N-methylpyridin-2-amine;prop-2-ene-1-thiol?
The InChIKey is SZZYLMWJTPSFCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2.C4H8.C3H6S/c1-3-7-5-4-6-10-8(7)9-2;1-3-4-2;1-2-3-4/h3-6H,1H2,2H3,(H,9,10);3H,1,4H2,2H3;2,4H,1,3H2.
What are the key properties of but-1-ene;3-ethenyl-N-methylpyridin-2-amine;prop-2-ene-1-thiol?
but-1-ene;3-ethenyl-N-methylpyridin-2-amine;prop-2-ene-1-thiol has a molecular weight of 264.44 g/mol, XLogP of 4.45, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;3-ethenyl-N-methylpyridin-2-amine;prop-2-ene-1-thiol is sourced from PubChem (CID 142838359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).