About 1-[2-(dimethylamino)ethyl]-3,5-dimethyl-2,6-dipyridin-2-ylpiperidin-4-one
1-[2-(dimethylamino)ethyl]-3,5-dimethyl-2,6-dipyridin-2-ylpiperidin-4-one (PubChem CID 142838497) has the molecular formula C21H28N4O
and a molecular weight of 352.48 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3,5-dimethyl-2,6-dipyridin-2-ylpiperidin-4-one.
Molecular Properties
| Compound Name | 1-[2-(dimethylamino)ethyl]-3,5-dimethyl-2,6-dipyridin-2-ylpiperidin-4-one |
| PubChem CID | 142838497 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3,5-dimethyl-2,6-dipyridin-2-ylpiperidin-4-one |
| SMILES | CC1C(=O)C(C)C(c2ccccn2)N(CCN(C)C)C1c1ccccn1 |
| InChI | InChI=1S/C21H28N4O/c1-15-19(17-9-5-7-11-22-17)25(14-13-24(3)4)20(16(2)21(15)26)18-10-6-8-12-23-18/h5-12,15-16,19-20H,13-14H2,1-4H3 |
| InChIKey | RTDYQKKCPFIWQB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-(dimethylamino)ethyl]-3,5-dimethyl-2,6-dipyridin-2-ylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(dimethylamino)ethyl]-3,5-dimethyl-2,6-dipyridin-2-ylpiperidin-4-one?
The IUPAC name of 1-[2-(dimethylamino)ethyl]-3,5-dimethyl-2,6-dipyridin-2-ylpiperidin-4-one (CID 142838497) is 1-[2-(dimethylamino)ethyl]-3,5-dimethyl-2,6-dipyridin-2-ylpiperidin-4-one.
What is the SMILES notation for 1-[2-(dimethylamino)ethyl]-3,5-dimethyl-2,6-dipyridin-2-ylpiperidin-4-one?
The canonical SMILES for 1-[2-(dimethylamino)ethyl]-3,5-dimethyl-2,6-dipyridin-2-ylpiperidin-4-one is CC1C(=O)C(C)C(c2ccccn2)N(CCN(C)C)C1c1ccccn1.
What is the InChIKey of 1-[2-(dimethylamino)ethyl]-3,5-dimethyl-2,6-dipyridin-2-ylpiperidin-4-one?
The InChIKey is RTDYQKKCPFIWQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N4O/c1-15-19(17-9-5-7-11-22-17)25(14-13-24(3)4)20(16(2)21(15)26)18-10-6-8-12-23-18/h5-12,15-16,19-20H,13-14H2,1-4H3.
What are the key properties of 1-[2-(dimethylamino)ethyl]-3,5-dimethyl-2,6-dipyridin-2-ylpiperidin-4-one?
1-[2-(dimethylamino)ethyl]-3,5-dimethyl-2,6-dipyridin-2-ylpiperidin-4-one has a molecular weight of 352.48 g/mol, XLogP of 2.98, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(dimethylamino)ethyl]-3,5-dimethyl-2,6-dipyridin-2-ylpiperidin-4-one is sourced from PubChem (CID 142838497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).