C15H22N2O — CID 142838621
3-[3-[[(1Z)-1-amino-2,3-dimethylbuta-1,3-dienyl]amino]phenyl]propan-1-ol (PubChem CID 142838621) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 3-[3-[[(1Z)-1-amino-2,3-dimethylbuta-1,3-dienyl]amino]phenyl]propan-1-ol.
| Compound Name | 3-[3-[[(1Z)-1-amino-2,3-dimethylbuta-1,3-dienyl]amino]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 142838621 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 3-[3-[[(1Z)-1-amino-2,3-dimethylbuta-1,3-dienyl]amino]phenyl]propan-1-ol |
| SMILES | C=C(C)/C(C)=C(/N)Nc1cccc(CCCO)c1 |
| InChI | InChI=1S/C15H22N2O/c1-11(2)12(3)15(16)17-14-8-4-6-13(10-14)7-5-9-18/h4,6,8,10,17-18H,1,5,7,9,16H2,2-3H3/b15-12- |
| InChIKey | JTUJMEXAJWQFAH-QINSGFPZSA-N |
| XLogP | 2.79 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|