C28H31N4O3- — CID 142838813
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-7-[3-(4-methanidylpiperazine-1-carbonyl)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 142838813) has the molecular formula C28H31N4O3- and a molecular weight of 471.58 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-7-[3-(4-methanidylpiperazine-1-carbonyl)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-7-[3-(4-methanidylpiperazine-1-carbonyl)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 142838813 |
| Molecular Formula | C28H31N4O3- |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-7-[3-(4-methanidylpiperazine-1-carbonyl)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | [CH2-]N1CCN(C(=O)c2cccc(-c3cccc4cc(C(=O)N[C@H]5CN6CCC5CC6)oc34)c2)CC1 |
| InChI | InChI=1S/C28H31N4O3/c1-30-12-14-32(15-13-30)28(34)22-6-2-4-20(16-22)23-7-3-5-21-17-25(35-26(21)23)27(33)29-24-18-31-10-8-19(24)9-11-31/h2-7,16-17,19,24H,1,8-15,18H2,(H,29,33)/q-1/t24-/m0/s1 |
| InChIKey | RGOQLVKQWDDKIP-DEOSSOPVSA-N |
| XLogP | 3.47 |
| TPSA | 69.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|