About (5E)-2,2-difluoro-5-[(Z)-2-methylbut-2-enylidene]-4-methylidene-1,3-oxazolidine
(5E)-2,2-difluoro-5-[(Z)-2-methylbut-2-enylidene]-4-methylidene-1,3-oxazolidine (PubChem CID 142839542) has the molecular formula C9H11F2NO
and a molecular weight of 187.19 g/mol. Its IUPAC name is (5E)-2,2-difluoro-5-[(Z)-2-methylbut-2-enylidene]-4-methylidene-1,3-oxazolidine.
Molecular Properties
| Compound Name | (5E)-2,2-difluoro-5-[(Z)-2-methylbut-2-enylidene]-4-methylidene-1,3-oxazolidine |
| PubChem CID | 142839542 |
| Molecular Formula | C9H11F2NO |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (5E)-2,2-difluoro-5-[(Z)-2-methylbut-2-enylidene]-4-methylidene-1,3-oxazolidine |
| SMILES | C=C1NC(F)(F)O/C1=C/C(C)=C\C |
| InChI | InChI=1S/C9H11F2NO/c1-4-6(2)5-8-7(3)12-9(10,11)13-8/h4-5,12H,3H2,1-2H3/b6-4-,8-5+ |
| InChIKey | KZWRJVUWQRXESP-QXMOYCCXSA-N |
| XLogP | 2.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (5E)-2,2-difluoro-5-[(Z)-2-methylbut-2-enylidene]-4-methylidene-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-2,2-difluoro-5-[(Z)-2-methylbut-2-enylidene]-4-methylidene-1,3-oxazolidine?
The IUPAC name of (5E)-2,2-difluoro-5-[(Z)-2-methylbut-2-enylidene]-4-methylidene-1,3-oxazolidine (CID 142839542) is (5E)-2,2-difluoro-5-[(Z)-2-methylbut-2-enylidene]-4-methylidene-1,3-oxazolidine.
What is the SMILES notation for (5E)-2,2-difluoro-5-[(Z)-2-methylbut-2-enylidene]-4-methylidene-1,3-oxazolidine?
The canonical SMILES for (5E)-2,2-difluoro-5-[(Z)-2-methylbut-2-enylidene]-4-methylidene-1,3-oxazolidine is C=C1NC(F)(F)O/C1=C/C(C)=C\C.
What is the InChIKey of (5E)-2,2-difluoro-5-[(Z)-2-methylbut-2-enylidene]-4-methylidene-1,3-oxazolidine?
The InChIKey is KZWRJVUWQRXESP-QXMOYCCXSA-N. The full InChI is InChI=1S/C9H11F2NO/c1-4-6(2)5-8-7(3)12-9(10,11)13-8/h4-5,12H,3H2,1-2H3/b6-4-,8-5+.
What are the key properties of (5E)-2,2-difluoro-5-[(Z)-2-methylbut-2-enylidene]-4-methylidene-1,3-oxazolidine?
(5E)-2,2-difluoro-5-[(Z)-2-methylbut-2-enylidene]-4-methylidene-1,3-oxazolidine has a molecular weight of 187.19 g/mol, XLogP of 2.52, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-2,2-difluoro-5-[(Z)-2-methylbut-2-enylidene]-4-methylidene-1,3-oxazolidine is sourced from PubChem (CID 142839542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).