C23H47N5 — CID 142839665
1-methyl-4-[(1-methylpiperidin-3-yl)methyl]piperazine;1-methyl-4-piperidin-1-ylpiperidine (PubChem CID 142839665) has the molecular formula C23H47N5 and a molecular weight of 393.66 g/mol. Its IUPAC name is 1-methyl-4-[(1-methylpiperidin-3-yl)methyl]piperazine;1-methyl-4-piperidin-1-ylpiperidine.
| Compound Name | 1-methyl-4-[(1-methylpiperidin-3-yl)methyl]piperazine;1-methyl-4-piperidin-1-ylpiperidine |
|---|---|
| PubChem CID | 142839665 |
| Molecular Formula | C23H47N5 |
| Molecular Weight | 393.66 g/mol |
| Exact Mass | 393.38 |
| IUPAC Name | 1-methyl-4-[(1-methylpiperidin-3-yl)methyl]piperazine;1-methyl-4-piperidin-1-ylpiperidine |
| SMILES | CN1CCC(N2CCCCC2)CC1.CN1CCN(CC2CCCN(C)C2)CC1 |
| InChI | InChI=1S/C12H25N3.C11H22N2/c1-13-6-8-15(9-7-13)11-12-4-3-5-14(2)10-12;1-12-9-5-11(6-10-12)13-7-3-2-4-8-13/h12H,3-11H2,1-2H3;11H,2-10H2,1H3 |
| InChIKey | AOWCNWKUKXXWPT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 16.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.66 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |