C14H27NO4 — CID 142839957
ethane;4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (PubChem CID 142839957) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is ethane;4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid.
| Compound Name | ethane;4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 142839957 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | ethane;4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| SMILES | CC.CC(C)(C)OC(=O)N1CCC(C)(C(=O)O)CC1 |
| InChI | InChI=1S/C12H21NO4.C2H6/c1-11(2,3)17-10(16)13-7-5-12(4,6-8-13)9(14)15;1-2/h5-8H2,1-4H3,(H,14,15);1-2H3 |
| InChIKey | RQFGVXFMZHQAPU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |