C29H42N6O3 — CID 142839975
1-(3-methoxypropyl)-3-[1-(1-methylpiperidine-4-carbonyl)piperidin-4-yl]benzimidazol-2-one;4-methylpyridin-2-amine (PubChem CID 142839975) has the molecular formula C29H42N6O3 and a molecular weight of 522.69 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-[1-(1-methylpiperidine-4-carbonyl)piperidin-4-yl]benzimidazol-2-one;4-methylpyridin-2-amine.
| Compound Name | 1-(3-methoxypropyl)-3-[1-(1-methylpiperidine-4-carbonyl)piperidin-4-yl]benzimidazol-2-one;4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 142839975 |
| Molecular Formula | C29H42N6O3 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | 1-(3-methoxypropyl)-3-[1-(1-methylpiperidine-4-carbonyl)piperidin-4-yl]benzimidazol-2-one;4-methylpyridin-2-amine |
| SMILES | COCCCn1c(=O)n(C2CCN(C(=O)C3CCN(C)CC3)CC2)c2ccccc21.Cc1ccnc(N)c1 |
| InChI | InChI=1S/C23H34N4O3.C6H8N2/c1-24-13-8-18(9-14-24)22(28)25-15-10-19(11-16-25)27-21-7-4-3-6-20(21)26(23(27)29)12-5-17-30-2;1-5-2-3-8-6(7)4-5/h3-4,6-7,18-19H,5,8-17H2,1-2H3;2-4H,1H3,(H2,7,8) |
| InChIKey | YVQMWXNTNUBFEV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|