C15H26N6O2S — CID 142840372
4-amino-1-[2-[2-(dimethylsulfinamoylamino)ethoxy]ethyl]-2,6,7-trimethylimidazo[4,5-c]pyridine (PubChem CID 142840372) has the molecular formula C15H26N6O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is 4-amino-1-[2-[2-(dimethylsulfinamoylamino)ethoxy]ethyl]-2,6,7-trimethylimidazo[4,5-c]pyridine.
| Compound Name | 4-amino-1-[2-[2-(dimethylsulfinamoylamino)ethoxy]ethyl]-2,6,7-trimethylimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 142840372 |
| Molecular Formula | C15H26N6O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 4-amino-1-[2-[2-(dimethylsulfinamoylamino)ethoxy]ethyl]-2,6,7-trimethylimidazo[4,5-c]pyridine |
| SMILES | Cc1nc(N)c2nc(C)n(CCOCCNS(=O)N(C)C)c2c1C |
| InChI | InChI=1S/C15H26N6O2S/c1-10-11(2)18-15(16)13-14(10)21(12(3)19-13)7-9-23-8-6-17-24(22)20(4)5/h17H,6-9H2,1-5H3,(H2,16,18) |
| InChIKey | WAYFLZFRWXJCPL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|