C19H29N3O — CID 142840603
(E)-but-2-ene;3-(5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocin-3-yl)-3-prop-2-enylcyclobutan-1-one (PubChem CID 142840603) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is (E)-but-2-ene;3-(5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocin-3-yl)-3-prop-2-enylcyclobutan-1-one.
| Compound Name | (E)-but-2-ene;3-(5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocin-3-yl)-3-prop-2-enylcyclobutan-1-one |
|---|---|
| PubChem CID | 142840603 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | (E)-but-2-ene;3-(5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocin-3-yl)-3-prop-2-enylcyclobutan-1-one |
| SMILES | C/C=C/C.C=CCC1(c2nnc3n2CCCCCC3)CC(=O)C1 |
| InChI | InChI=1S/C15H21N3O.C4H8/c1-2-8-15(10-12(19)11-15)14-17-16-13-7-5-3-4-6-9-18(13)14;1-3-4-2/h2H,1,3-11H2;3-4H,1-2H3/b;4-3+ |
| InChIKey | UWGPMFLIKHPZHK-SCBDLNNBSA-N |
| XLogP | 4.15 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|