C12H15ClO2 — CID 142840615
[(2R,4R)-4-(4-chlorophenyl)pentan-2-yl] formate (PubChem CID 142840615) has the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. Its IUPAC name is [(2R,4R)-4-(4-chlorophenyl)pentan-2-yl] formate.
| Compound Name | [(2R,4R)-4-(4-chlorophenyl)pentan-2-yl] formate |
|---|---|
| PubChem CID | 142840615 |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | [(2R,4R)-4-(4-chlorophenyl)pentan-2-yl] formate |
| SMILES | C[C@H](C[C@@H](C)c1ccc(Cl)cc1)OC=O |
| InChI | InChI=1S/C12H15ClO2/c1-9(7-10(2)15-8-14)11-3-5-12(13)6-4-11/h3-6,8-10H,7H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | FFHOQFLHCZNCSI-NXEZZACHSA-N |
| XLogP | 3.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.70 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|