C29H43IN4S — CID 142840718
4-[3-[4-(dimethyl-λ3-iodanyl)phenyl]-4-pyrimidin-4-yl-1,2-thiazol-5-yl]-N-propan-2-yl-N-propylcyclohexan-1-amine;ethane (PubChem CID 142840718) has the molecular formula C29H43IN4S and a molecular weight of 606.66 g/mol. Its IUPAC name is 4-[3-[4-(dimethyl-λ3-iodanyl)phenyl]-4-pyrimidin-4-yl-1,2-thiazol-5-yl]-N-propan-2-yl-N-propylcyclohexan-1-amine;ethane.
| Compound Name | 4-[3-[4-(dimethyl-λ3-iodanyl)phenyl]-4-pyrimidin-4-yl-1,2-thiazol-5-yl]-N-propan-2-yl-N-propylcyclohexan-1-amine;ethane |
|---|---|
| PubChem CID | 142840718 |
| Molecular Formula | C29H43IN4S |
| Molecular Weight | 606.66 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | 4-[3-[4-(dimethyl-λ3-iodanyl)phenyl]-4-pyrimidin-4-yl-1,2-thiazol-5-yl]-N-propan-2-yl-N-propylcyclohexan-1-amine;ethane |
| SMILES | CC.CCCN(C(C)C)C1CCC(c2snc(-c3ccc(I(C)C)cc3)c2-c2ccncn2)CC1 |
| InChI | InChI=1S/C27H37IN4S.C2H6/c1-6-17-32(19(2)3)23-13-9-21(10-14-23)27-25(24-15-16-29-18-30-24)26(31-33-27)20-7-11-22(12-8-20)28(4)5;1-2/h7-8,11-12,15-16,18-19,21,23H,6,9-10,13-14,17H2,1-5H3;1-2H3 |
| InChIKey | ISHRTJNDAVJNKI-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.66 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|