About 2-(2-hydroxycyclohexa-1,3-dien-1-yl)phenol
2-(2-hydroxycyclohexa-1,3-dien-1-yl)phenol (PubChem CID 142841188) has the molecular formula C12H12O2
and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-(2-hydroxycyclohexa-1,3-dien-1-yl)phenol.
Molecular Properties
| Compound Name | 2-(2-hydroxycyclohexa-1,3-dien-1-yl)phenol |
| PubChem CID | 142841188 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2-(2-hydroxycyclohexa-1,3-dien-1-yl)phenol |
| SMILES | OC1=C(c2ccccc2O)CCC=C1 |
| InChI | InChI=1S/C12H12O2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1,3-5,7-8,13-14H,2,6H2 |
| InChIKey | MMNKQQLMDATOOV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-hydroxycyclohexa-1,3-dien-1-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxycyclohexa-1,3-dien-1-yl)phenol?
The IUPAC name of 2-(2-hydroxycyclohexa-1,3-dien-1-yl)phenol (CID 142841188) is 2-(2-hydroxycyclohexa-1,3-dien-1-yl)phenol.
What is the SMILES notation for 2-(2-hydroxycyclohexa-1,3-dien-1-yl)phenol?
The canonical SMILES for 2-(2-hydroxycyclohexa-1,3-dien-1-yl)phenol is OC1=C(c2ccccc2O)CCC=C1.
What is the InChIKey of 2-(2-hydroxycyclohexa-1,3-dien-1-yl)phenol?
The InChIKey is MMNKQQLMDATOOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1,3-5,7-8,13-14H,2,6H2.
What are the key properties of 2-(2-hydroxycyclohexa-1,3-dien-1-yl)phenol?
2-(2-hydroxycyclohexa-1,3-dien-1-yl)phenol has a molecular weight of 188.23 g/mol, XLogP of 3.01, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxycyclohexa-1,3-dien-1-yl)phenol is sourced from PubChem (CID 142841188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).