C10H11F3N2O — CID 142841608
1-[(3E)-4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]imidazolidin-4-one (PubChem CID 142841608) has the molecular formula C10H11F3N2O and a molecular weight of 232.20 g/mol. Its IUPAC name is 1-[(3E)-4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]imidazolidin-4-one.
| Compound Name | 1-[(3E)-4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]imidazolidin-4-one |
|---|---|
| PubChem CID | 142841608 |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-[(3E)-4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]imidazolidin-4-one |
| SMILES | C=C/C(=C\C(=C)N1CNC(=O)C1)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O/c1-3-8(10(11,12)13)4-7(2)15-5-9(16)14-6-15/h3-4H,1-2,5-6H2,(H,14,16)/b8-4+ |
| InChIKey | OOJIYHGEZNYRRG-XBXARRHUSA-N |
| XLogP | 1.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|