C5H11N3O — CID 142841618
3-ethyl-4-methyl-1,5-dihydro-1,2,4-triazol-5-ol (PubChem CID 142841618) has the molecular formula C5H11N3O and a molecular weight of 129.16 g/mol. Its IUPAC name is 3-ethyl-4-methyl-1,5-dihydro-1,2,4-triazol-5-ol.
| Compound Name | 3-ethyl-4-methyl-1,5-dihydro-1,2,4-triazol-5-ol |
|---|---|
| PubChem CID | 142841618 |
| Molecular Formula | C5H11N3O |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.09 |
| IUPAC Name | 3-ethyl-4-methyl-1,5-dihydro-1,2,4-triazol-5-ol |
| SMILES | CCC1=NNC(O)N1C |
| InChI | InChI=1S/C5H11N3O/c1-3-4-6-7-5(9)8(4)2/h5,7,9H,3H2,1-2H3 |
| InChIKey | ASCOHSPLVYSFHV-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |