C15H13BrN2S — CID 142841743
(E)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]hex-3-enenitrile (PubChem CID 142841743) has the molecular formula C15H13BrN2S and a molecular weight of 333.25 g/mol. Its IUPAC name is (E)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]hex-3-enenitrile.
| Compound Name | (E)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]hex-3-enenitrile |
|---|---|
| PubChem CID | 142841743 |
| Molecular Formula | C15H13BrN2S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | (E)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]hex-3-enenitrile |
| SMILES | CC/C=C/C(C#N)c1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C15H13BrN2S/c1-2-3-4-12(9-17)15-18-14(10-19-15)11-5-7-13(16)8-6-11/h3-8,10,12H,2H2,1H3/b4-3+ |
| InChIKey | NJJZYZJKCBUNBV-ONEGZZNKSA-N |
| XLogP | 5.15 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|