C20H24ClN3O — CID 142841853
(Z,2E)-1-(5-chlorospiro[2H-indole-3,4'-piperidine]-1-yl)-2-ethylidene-4-(methylideneamino)pent-3-en-1-one (PubChem CID 142841853) has the molecular formula C20H24ClN3O and a molecular weight of 357.89 g/mol. Its IUPAC name is (Z,2E)-1-(5-chlorospiro[2H-indole-3,4'-piperidine]-1-yl)-2-ethylidene-4-(methylideneamino)pent-3-en-1-one.
| Compound Name | (Z,2E)-1-(5-chlorospiro[2H-indole-3,4'-piperidine]-1-yl)-2-ethylidene-4-(methylideneamino)pent-3-en-1-one |
|---|---|
| PubChem CID | 142841853 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (Z,2E)-1-(5-chlorospiro[2H-indole-3,4'-piperidine]-1-yl)-2-ethylidene-4-(methylideneamino)pent-3-en-1-one |
| SMILES | C=N/C(C)=C\C(=C/C)C(=O)N1CC2(CCNCC2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H24ClN3O/c1-4-15(11-14(2)22-3)19(25)24-13-20(7-9-23-10-8-20)17-12-16(21)5-6-18(17)24/h4-6,11-12,23H,3,7-10,13H2,1-2H3/b14-11-,15-4+ |
| InChIKey | FUMIJSMTOACARU-XLJDZNPXSA-N |
| XLogP | 3.86 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|