C26H30N4O3S — CID 142841931
benzyl formate;ethane;2-[[4-(methylamino)phenyl]sulfanylmethyl]-1H-benzimidazole-4-carboxamide (PubChem CID 142841931) has the molecular formula C26H30N4O3S and a molecular weight of 478.62 g/mol. Its IUPAC name is benzyl formate;ethane;2-[[4-(methylamino)phenyl]sulfanylmethyl]-1H-benzimidazole-4-carboxamide.
| Compound Name | benzyl formate;ethane;2-[[4-(methylamino)phenyl]sulfanylmethyl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 142841931 |
| Molecular Formula | C26H30N4O3S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | benzyl formate;ethane;2-[[4-(methylamino)phenyl]sulfanylmethyl]-1H-benzimidazole-4-carboxamide |
| SMILES | CC.CNc1ccc(SCc2nc3c(C(N)=O)cccc3[nH]2)cc1.O=COCc1ccccc1 |
| InChI | InChI=1S/C16H16N4OS.C8H8O2.C2H6/c1-18-10-5-7-11(8-6-10)22-9-14-19-13-4-2-3-12(16(17)21)15(13)20-14;9-7-10-6-8-4-2-1-3-5-8;1-2/h2-8,18H,9H2,1H3,(H2,17,21)(H,19,20);1-5,7H,6H2;1-2H3 |
| InChIKey | GXNOWUMTGTXMKO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|