About ethane;1-(hydroxymethylsulfanyl)propyl acetate;1-methylpyrrolidine
ethane;1-(hydroxymethylsulfanyl)propyl acetate;1-methylpyrrolidine (PubChem CID 142842254) has the molecular formula C13H29NO3S
and a molecular weight of 279.45 g/mol. Its IUPAC name is ethane;1-(hydroxymethylsulfanyl)propyl acetate;1-methylpyrrolidine.
Molecular Properties
| Compound Name | ethane;1-(hydroxymethylsulfanyl)propyl acetate;1-methylpyrrolidine |
| PubChem CID | 142842254 |
| Molecular Formula | C13H29NO3S |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | ethane;1-(hydroxymethylsulfanyl)propyl acetate;1-methylpyrrolidine |
| SMILES | CC.CCC(OC(C)=O)SCO.CN1CCCC1 |
| InChI | InChI=1S/C6H12O3S.C5H11N.C2H6/c1-3-6(10-4-7)9-5(2)8;1-6-4-2-3-5-6;1-2/h6-7H,3-4H2,1-2H3;2-5H2,1H3;1-2H3 |
| InChIKey | IKUJHTFGGVHJHG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(hydroxymethylsulfanyl)propyl acetate;1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(hydroxymethylsulfanyl)propyl acetate;1-methylpyrrolidine?
The IUPAC name of ethane;1-(hydroxymethylsulfanyl)propyl acetate;1-methylpyrrolidine (CID 142842254) is ethane;1-(hydroxymethylsulfanyl)propyl acetate;1-methylpyrrolidine.
What is the SMILES notation for ethane;1-(hydroxymethylsulfanyl)propyl acetate;1-methylpyrrolidine?
The canonical SMILES for ethane;1-(hydroxymethylsulfanyl)propyl acetate;1-methylpyrrolidine is CC.CCC(OC(C)=O)SCO.CN1CCCC1.
What is the InChIKey of ethane;1-(hydroxymethylsulfanyl)propyl acetate;1-methylpyrrolidine?
The InChIKey is IKUJHTFGGVHJHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3S.C5H11N.C2H6/c1-3-6(10-4-7)9-5(2)8;1-6-4-2-3-5-6;1-2/h6-7H,3-4H2,1-2H3;2-5H2,1H3;1-2H3.
What are the key properties of ethane;1-(hydroxymethylsulfanyl)propyl acetate;1-methylpyrrolidine?
ethane;1-(hydroxymethylsulfanyl)propyl acetate;1-methylpyrrolidine has a molecular weight of 279.45 g/mol, XLogP of 2.71, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(hydroxymethylsulfanyl)propyl acetate;1-methylpyrrolidine is sourced from PubChem (CID 142842254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).