C15H19NO3 — CID 142842352
3-[(E)-pent-2-enoyl]-1,3-oxazolidin-2-one;toluene (PubChem CID 142842352) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 3-[(E)-pent-2-enoyl]-1,3-oxazolidin-2-one;toluene.
| Compound Name | 3-[(E)-pent-2-enoyl]-1,3-oxazolidin-2-one;toluene |
|---|---|
| PubChem CID | 142842352 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 3-[(E)-pent-2-enoyl]-1,3-oxazolidin-2-one;toluene |
| SMILES | CC/C=C/C(=O)N1CCOC1=O.Cc1ccccc1 |
| InChI | InChI=1S/C8H11NO3.C7H8/c1-2-3-4-7(10)9-5-6-12-8(9)11;1-7-5-3-2-4-6-7/h3-4H,2,5-6H2,1H3;2-6H,1H3/b4-3+; |
| InChIKey | HDTKEJYWTKBRHL-BJILWQEISA-N |
| XLogP | 2.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|