C25H24N2O5S — CID 142842362
N-[4-[(E)-3-oxo-3-(2-oxo-1,3-oxazolidin-3-yl)prop-1-enyl]phenyl]benzenesulfonamide;toluene (PubChem CID 142842362) has the molecular formula C25H24N2O5S and a molecular weight of 464.54 g/mol. Its IUPAC name is N-[4-[(E)-3-oxo-3-(2-oxo-1,3-oxazolidin-3-yl)prop-1-enyl]phenyl]benzenesulfonamide;toluene.
| Compound Name | N-[4-[(E)-3-oxo-3-(2-oxo-1,3-oxazolidin-3-yl)prop-1-enyl]phenyl]benzenesulfonamide;toluene |
|---|---|
| PubChem CID | 142842362 |
| Molecular Formula | C25H24N2O5S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | N-[4-[(E)-3-oxo-3-(2-oxo-1,3-oxazolidin-3-yl)prop-1-enyl]phenyl]benzenesulfonamide;toluene |
| SMILES | Cc1ccccc1.O=C(/C=C/c1ccc(NS(=O)(=O)c2ccccc2)cc1)N1CCOC1=O |
| InChI | InChI=1S/C18H16N2O5S.C7H8/c21-17(20-12-13-25-18(20)22)11-8-14-6-9-15(10-7-14)19-26(23,24)16-4-2-1-3-5-16;1-7-5-3-2-4-6-7/h1-11,19H,12-13H2;2-6H,1H3/b11-8+; |
| InChIKey | ZYJREHSJYFXNMW-YGCVIUNWSA-N |
| XLogP | 4.47 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|