About 4-[1-(3,5-dimethylphenyl)ethyl]-2,6-dimethylphenol
4-[1-(3,5-dimethylphenyl)ethyl]-2,6-dimethylphenol (PubChem CID 142842410) has the molecular formula C18H22O
and a molecular weight of 254.37 g/mol. Its IUPAC name is 4-[1-(3,5-dimethylphenyl)ethyl]-2,6-dimethylphenol.
Molecular Properties
| Compound Name | 4-[1-(3,5-dimethylphenyl)ethyl]-2,6-dimethylphenol |
| PubChem CID | 142842410 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 4-[1-(3,5-dimethylphenyl)ethyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(C)cc(C(C)c2cc(C)c(O)c(C)c2)c1 |
| InChI | InChI=1S/C18H22O/c1-11-6-12(2)8-16(7-11)15(5)17-9-13(3)18(19)14(4)10-17/h6-10,15,19H,1-5H3 |
| InChIKey | ZRHATASNTAGWCO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[1-(3,5-dimethylphenyl)ethyl]-2,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(3,5-dimethylphenyl)ethyl]-2,6-dimethylphenol?
The IUPAC name of 4-[1-(3,5-dimethylphenyl)ethyl]-2,6-dimethylphenol (CID 142842410) is 4-[1-(3,5-dimethylphenyl)ethyl]-2,6-dimethylphenol.
What is the SMILES notation for 4-[1-(3,5-dimethylphenyl)ethyl]-2,6-dimethylphenol?
The canonical SMILES for 4-[1-(3,5-dimethylphenyl)ethyl]-2,6-dimethylphenol is Cc1cc(C)cc(C(C)c2cc(C)c(O)c(C)c2)c1.
What is the InChIKey of 4-[1-(3,5-dimethylphenyl)ethyl]-2,6-dimethylphenol?
The InChIKey is ZRHATASNTAGWCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O/c1-11-6-12(2)8-16(7-11)15(5)17-9-13(3)18(19)14(4)10-17/h6-10,15,19H,1-5H3.
What are the key properties of 4-[1-(3,5-dimethylphenyl)ethyl]-2,6-dimethylphenol?
4-[1-(3,5-dimethylphenyl)ethyl]-2,6-dimethylphenol has a molecular weight of 254.37 g/mol, XLogP of 4.78, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(3,5-dimethylphenyl)ethyl]-2,6-dimethylphenol is sourced from PubChem (CID 142842410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).