About (7-iodosulfanyl-1,4,7,10-tetrazacyclododec-1-yl) thiohypoiodite
(7-iodosulfanyl-1,4,7,10-tetrazacyclododec-1-yl) thiohypoiodite (PubChem CID 142842664) has the molecular formula C8H18I2N4S2
and a molecular weight of 488.20 g/mol. Its IUPAC name is (7-iodosulfanyl-1,4,7,10-tetrazacyclododec-1-yl) thiohypoiodite.
Molecular Properties
| Compound Name | (7-iodosulfanyl-1,4,7,10-tetrazacyclododec-1-yl) thiohypoiodite |
| PubChem CID | 142842664 |
| Molecular Formula | C8H18I2N4S2 |
| Molecular Weight | 488.20 g/mol |
| Exact Mass | 487.91 |
| IUPAC Name | (7-iodosulfanyl-1,4,7,10-tetrazacyclododec-1-yl) thiohypoiodite |
| SMILES | ISN1CCNCCN(SI)CCNCC1 |
| InChI | InChI=1S/C8H18I2N4S2/c9-15-13-5-1-11-2-6-14(16-10)8-4-12-3-7-13/h11-12H,1-8H2 |
| InChIKey | ZTOGIKRKAITLMG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (7-iodosulfanyl-1,4,7,10-tetrazacyclododec-1-yl) thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-iodosulfanyl-1,4,7,10-tetrazacyclododec-1-yl) thiohypoiodite?
The IUPAC name of (7-iodosulfanyl-1,4,7,10-tetrazacyclododec-1-yl) thiohypoiodite (CID 142842664) is (7-iodosulfanyl-1,4,7,10-tetrazacyclododec-1-yl) thiohypoiodite.
What is the SMILES notation for (7-iodosulfanyl-1,4,7,10-tetrazacyclododec-1-yl) thiohypoiodite?
The canonical SMILES for (7-iodosulfanyl-1,4,7,10-tetrazacyclododec-1-yl) thiohypoiodite is ISN1CCNCCN(SI)CCNCC1.
What is the InChIKey of (7-iodosulfanyl-1,4,7,10-tetrazacyclododec-1-yl) thiohypoiodite?
The InChIKey is ZTOGIKRKAITLMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18I2N4S2/c9-15-13-5-1-11-2-6-14(16-10)8-4-12-3-7-13/h11-12H,1-8H2.
What are the key properties of (7-iodosulfanyl-1,4,7,10-tetrazacyclododec-1-yl) thiohypoiodite?
(7-iodosulfanyl-1,4,7,10-tetrazacyclododec-1-yl) thiohypoiodite has a molecular weight of 488.20 g/mol, XLogP of 1.78, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (7-iodosulfanyl-1,4,7,10-tetrazacyclododec-1-yl) thiohypoiodite is sourced from PubChem (CID 142842664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).