About (4-iodosulfanyl-1,4,7-triazonan-1-yl) thiohypoiodite
(4-iodosulfanyl-1,4,7-triazonan-1-yl) thiohypoiodite (PubChem CID 142842669) has the molecular formula C6H13I2N3S2
and a molecular weight of 445.13 g/mol. Its IUPAC name is (4-iodosulfanyl-1,4,7-triazonan-1-yl) thiohypoiodite.
Molecular Properties
| Compound Name | (4-iodosulfanyl-1,4,7-triazonan-1-yl) thiohypoiodite |
| PubChem CID | 142842669 |
| Molecular Formula | C6H13I2N3S2 |
| Molecular Weight | 445.13 g/mol |
| Exact Mass | 444.86 |
| IUPAC Name | (4-iodosulfanyl-1,4,7-triazonan-1-yl) thiohypoiodite |
| SMILES | ISN1CCNCCN(SI)CC1 |
| InChI | InChI=1S/C6H13I2N3S2/c7-12-10-3-1-9-2-4-11(13-8)6-5-10/h9H,1-6H2 |
| InChIKey | CITPZAUKHMVFGK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.13 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-iodosulfanyl-1,4,7-triazonan-1-yl) thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-iodosulfanyl-1,4,7-triazonan-1-yl) thiohypoiodite?
The IUPAC name of (4-iodosulfanyl-1,4,7-triazonan-1-yl) thiohypoiodite (CID 142842669) is (4-iodosulfanyl-1,4,7-triazonan-1-yl) thiohypoiodite.
What is the SMILES notation for (4-iodosulfanyl-1,4,7-triazonan-1-yl) thiohypoiodite?
The canonical SMILES for (4-iodosulfanyl-1,4,7-triazonan-1-yl) thiohypoiodite is ISN1CCNCCN(SI)CC1.
What is the InChIKey of (4-iodosulfanyl-1,4,7-triazonan-1-yl) thiohypoiodite?
The InChIKey is CITPZAUKHMVFGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13I2N3S2/c7-12-10-3-1-9-2-4-11(13-8)6-5-10/h9H,1-6H2.
What are the key properties of (4-iodosulfanyl-1,4,7-triazonan-1-yl) thiohypoiodite?
(4-iodosulfanyl-1,4,7-triazonan-1-yl) thiohypoiodite has a molecular weight of 445.13 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-iodosulfanyl-1,4,7-triazonan-1-yl) thiohypoiodite is sourced from PubChem (CID 142842669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).