C27H26F2N2O — CID 142843015
4-(2,5-difluorophenyl)-2-phenyl-2,5-dihydropyrrole-1-carbaldehyde;2-phenylpyrrolidine (PubChem CID 142843015) has the molecular formula C27H26F2N2O and a molecular weight of 432.51 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-2-phenyl-2,5-dihydropyrrole-1-carbaldehyde;2-phenylpyrrolidine.
| Compound Name | 4-(2,5-difluorophenyl)-2-phenyl-2,5-dihydropyrrole-1-carbaldehyde;2-phenylpyrrolidine |
|---|---|
| PubChem CID | 142843015 |
| Molecular Formula | C27H26F2N2O |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 4-(2,5-difluorophenyl)-2-phenyl-2,5-dihydropyrrole-1-carbaldehyde;2-phenylpyrrolidine |
| SMILES | O=CN1CC(c2cc(F)ccc2F)=CC1c1ccccc1.c1ccc(C2CCCN2)cc1 |
| InChI | InChI=1S/C17H13F2NO.C10H13N/c18-14-6-7-16(19)15(9-14)13-8-17(20(10-13)11-21)12-4-2-1-3-5-12;1-2-5-9(6-3-1)10-7-4-8-11-10/h1-9,11,17H,10H2;1-3,5-6,10-11H,4,7-8H2 |
| InChIKey | KWSFJYQMNDYJRZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|