About methoxyethane;3-(pyrrolidine-1-carbonyl)benzoic acid
methoxyethane;3-(pyrrolidine-1-carbonyl)benzoic acid (PubChem CID 142843675) has the molecular formula C15H21NO4
and a molecular weight of 279.34 g/mol. Its IUPAC name is methoxyethane;3-(pyrrolidine-1-carbonyl)benzoic acid.
Molecular Properties
| Compound Name | methoxyethane;3-(pyrrolidine-1-carbonyl)benzoic acid |
| PubChem CID | 142843675 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | methoxyethane;3-(pyrrolidine-1-carbonyl)benzoic acid |
| SMILES | CCOC.O=C(O)c1cccc(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C12H13NO3.C3H8O/c14-11(13-6-1-2-7-13)9-4-3-5-10(8-9)12(15)16;1-3-4-2/h3-5,8H,1-2,6-7H2,(H,15,16);3H2,1-2H3 |
| InChIKey | QZSISISLPFPTET-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methoxyethane;3-(pyrrolidine-1-carbonyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxyethane;3-(pyrrolidine-1-carbonyl)benzoic acid?
The IUPAC name of methoxyethane;3-(pyrrolidine-1-carbonyl)benzoic acid (CID 142843675) is methoxyethane;3-(pyrrolidine-1-carbonyl)benzoic acid.
What is the SMILES notation for methoxyethane;3-(pyrrolidine-1-carbonyl)benzoic acid?
The canonical SMILES for methoxyethane;3-(pyrrolidine-1-carbonyl)benzoic acid is CCOC.O=C(O)c1cccc(C(=O)N2CCCC2)c1.
What is the InChIKey of methoxyethane;3-(pyrrolidine-1-carbonyl)benzoic acid?
The InChIKey is QZSISISLPFPTET-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3.C3H8O/c14-11(13-6-1-2-7-13)9-4-3-5-10(8-9)12(15)16;1-3-4-2/h3-5,8H,1-2,6-7H2,(H,15,16);3H2,1-2H3.
What are the key properties of methoxyethane;3-(pyrrolidine-1-carbonyl)benzoic acid?
methoxyethane;3-(pyrrolidine-1-carbonyl)benzoic acid has a molecular weight of 279.34 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methoxyethane;3-(pyrrolidine-1-carbonyl)benzoic acid is sourced from PubChem (CID 142843675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).