C17H26N2O3S — CID 142843911
3-(1,1-dioxo-1,2-thiazolidin-2-yl)-5-methyl-N,N-dipropylbenzamide (PubChem CID 142843911) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-5-methyl-N,N-dipropylbenzamide.
| Compound Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-5-methyl-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 142843911 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-5-methyl-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C17H26N2O3S/c1-4-7-18(8-5-2)17(20)15-11-14(3)12-16(13-15)19-9-6-10-23(19,21)22/h11-13H,4-10H2,1-3H3 |
| InChIKey | QVMRRRCFXGZAQE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |