C8H12N2 — CID 142843949
2-[(3E)-penta-1,3-dien-3-yl]-4,5-dihydro-1H-imidazole (PubChem CID 142843949) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 2-[(3E)-penta-1,3-dien-3-yl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[(3E)-penta-1,3-dien-3-yl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 142843949 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 2-[(3E)-penta-1,3-dien-3-yl]-4,5-dihydro-1H-imidazole |
| SMILES | C=C/C(=C\C)C1=NCCN1 |
| InChI | InChI=1S/C8H12N2/c1-3-7(4-2)8-9-5-6-10-8/h3-4H,1,5-6H2,2H3,(H,9,10)/b7-4+ |
| InChIKey | OJPHIFYMRSENNJ-QPJJXVBHSA-N |
| XLogP | 1.12 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|