C22H48N3O2+ — CID 142844368
3-[[2-(2,6-diethyl-2,3,6-trimethylpiperidin-1-yl)oxy-1-hydroxypropyl]amino]propyl-ethyl-dimethylazanium (PubChem CID 142844368) has the molecular formula C22H48N3O2+ and a molecular weight of 386.65 g/mol. Its IUPAC name is 3-[[2-(2,6-diethyl-2,3,6-trimethylpiperidin-1-yl)oxy-1-hydroxypropyl]amino]propyl-ethyl-dimethylazanium.
| Compound Name | 3-[[2-(2,6-diethyl-2,3,6-trimethylpiperidin-1-yl)oxy-1-hydroxypropyl]amino]propyl-ethyl-dimethylazanium |
|---|---|
| PubChem CID | 142844368 |
| Molecular Formula | C22H48N3O2+ |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.37 |
| IUPAC Name | 3-[[2-(2,6-diethyl-2,3,6-trimethylpiperidin-1-yl)oxy-1-hydroxypropyl]amino]propyl-ethyl-dimethylazanium |
| SMILES | CCC1(C)CCC(C)C(C)(CC)N1OC(C)C(O)NCCC[N+](C)(C)CC |
| InChI | InChI=1S/C22H48N3O2/c1-10-21(6)15-14-18(4)22(7,11-2)24(21)27-19(5)20(26)23-16-13-17-25(8,9)12-3/h18-20,23,26H,10-17H2,1-9H3/q+1 |
| InChIKey | QWTJBPVRVVWJCQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|