About N-(2-methoxyethyl)-6-methyl-N-[(E)-2-methylpent-2-enyl]cyclohepta-1,3,5-trien-1-amine
N-(2-methoxyethyl)-6-methyl-N-[(E)-2-methylpent-2-enyl]cyclohepta-1,3,5-trien-1-amine (PubChem CID 142844445) has the molecular formula C17H27NO
and a molecular weight of 261.41 g/mol. Its IUPAC name is N-(2-methoxyethyl)-6-methyl-N-[(E)-2-methylpent-2-enyl]cyclohepta-1,3,5-trien-1-amine.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)-6-methyl-N-[(E)-2-methylpent-2-enyl]cyclohepta-1,3,5-trien-1-amine |
| PubChem CID | 142844445 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | N-(2-methoxyethyl)-6-methyl-N-[(E)-2-methylpent-2-enyl]cyclohepta-1,3,5-trien-1-amine |
| SMILES | CC/C=C(\C)CN(CCOC)C1=CC=CC=C(C)C1 |
| InChI | InChI=1S/C17H27NO/c1-5-8-16(3)14-18(11-12-19-4)17-10-7-6-9-15(2)13-17/h6-10H,5,11-14H2,1-4H3/b16-8+ |
| InChIKey | WEWGPUJCHZFUIS-LZYBPNLTSA-N |
| XLogP | 4.08 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethyl)-6-methyl-N-[(E)-2-methylpent-2-enyl]cyclohepta-1,3,5-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)-6-methyl-N-[(E)-2-methylpent-2-enyl]cyclohepta-1,3,5-trien-1-amine?
The IUPAC name of N-(2-methoxyethyl)-6-methyl-N-[(E)-2-methylpent-2-enyl]cyclohepta-1,3,5-trien-1-amine (CID 142844445) is N-(2-methoxyethyl)-6-methyl-N-[(E)-2-methylpent-2-enyl]cyclohepta-1,3,5-trien-1-amine.
What is the SMILES notation for N-(2-methoxyethyl)-6-methyl-N-[(E)-2-methylpent-2-enyl]cyclohepta-1,3,5-trien-1-amine?
The canonical SMILES for N-(2-methoxyethyl)-6-methyl-N-[(E)-2-methylpent-2-enyl]cyclohepta-1,3,5-trien-1-amine is CC/C=C(\C)CN(CCOC)C1=CC=CC=C(C)C1.
What is the InChIKey of N-(2-methoxyethyl)-6-methyl-N-[(E)-2-methylpent-2-enyl]cyclohepta-1,3,5-trien-1-amine?
The InChIKey is WEWGPUJCHZFUIS-LZYBPNLTSA-N. The full InChI is InChI=1S/C17H27NO/c1-5-8-16(3)14-18(11-12-19-4)17-10-7-6-9-15(2)13-17/h6-10H,5,11-14H2,1-4H3/b16-8+.
What are the key properties of N-(2-methoxyethyl)-6-methyl-N-[(E)-2-methylpent-2-enyl]cyclohepta-1,3,5-trien-1-amine?
N-(2-methoxyethyl)-6-methyl-N-[(E)-2-methylpent-2-enyl]cyclohepta-1,3,5-trien-1-amine has a molecular weight of 261.41 g/mol, XLogP of 4.08, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-6-methyl-N-[(E)-2-methylpent-2-enyl]cyclohepta-1,3,5-trien-1-amine is sourced from PubChem (CID 142844445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).