About (5Z)-5-ethylidene-2,4-dimethylidene-1,3-thiazolidine
(5Z)-5-ethylidene-2,4-dimethylidene-1,3-thiazolidine (PubChem CID 142844801) has the molecular formula C7H9NS
and a molecular weight of 139.22 g/mol. Its IUPAC name is (5Z)-5-ethylidene-2,4-dimethylidene-1,3-thiazolidine.
Molecular Properties
| Compound Name | (5Z)-5-ethylidene-2,4-dimethylidene-1,3-thiazolidine |
| PubChem CID | 142844801 |
| Molecular Formula | C7H9NS |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | (5Z)-5-ethylidene-2,4-dimethylidene-1,3-thiazolidine |
| SMILES | C=C1NC(=C)/C(=C/C)S1 |
| InChI | InChI=1S/C7H9NS/c1-4-7-5(2)8-6(3)9-7/h4,8H,2-3H2,1H3/b7-4- |
| InChIKey | PZDIQBGPOHWHPE-DAXSKMNVSA-N |
| XLogP | 2.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5Z)-5-ethylidene-2,4-dimethylidene-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-ethylidene-2,4-dimethylidene-1,3-thiazolidine?
The IUPAC name of (5Z)-5-ethylidene-2,4-dimethylidene-1,3-thiazolidine (CID 142844801) is (5Z)-5-ethylidene-2,4-dimethylidene-1,3-thiazolidine.
What is the SMILES notation for (5Z)-5-ethylidene-2,4-dimethylidene-1,3-thiazolidine?
The canonical SMILES for (5Z)-5-ethylidene-2,4-dimethylidene-1,3-thiazolidine is C=C1NC(=C)/C(=C/C)S1.
What is the InChIKey of (5Z)-5-ethylidene-2,4-dimethylidene-1,3-thiazolidine?
The InChIKey is PZDIQBGPOHWHPE-DAXSKMNVSA-N. The full InChI is InChI=1S/C7H9NS/c1-4-7-5(2)8-6(3)9-7/h4,8H,2-3H2,1H3/b7-4-.
What are the key properties of (5Z)-5-ethylidene-2,4-dimethylidene-1,3-thiazolidine?
(5Z)-5-ethylidene-2,4-dimethylidene-1,3-thiazolidine has a molecular weight of 139.22 g/mol, XLogP of 2.21, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-ethylidene-2,4-dimethylidene-1,3-thiazolidine is sourced from PubChem (CID 142844801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).