C33H50O4 — CID 142845286
4-[10,13-dimethyl-3-[2-(2-methylphenoxy)ethoxy]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 142845286) has the molecular formula C33H50O4 and a molecular weight of 510.76 g/mol. Its IUPAC name is 4-[10,13-dimethyl-3-[2-(2-methylphenoxy)ethoxy]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | 4-[10,13-dimethyl-3-[2-(2-methylphenoxy)ethoxy]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 142845286 |
| Molecular Formula | C33H50O4 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | 4-[10,13-dimethyl-3-[2-(2-methylphenoxy)ethoxy]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | Cc1ccccc1OCCOC1CCC2(C)C(CCC3C2CCC2(C)C(C(C)CCC(=O)O)CCC32)C1 |
| InChI | InChI=1S/C33H50O4/c1-22(9-14-31(34)35)27-12-13-28-26-11-10-24-21-25(36-19-20-37-30-8-6-5-7-23(30)2)15-17-32(24,3)29(26)16-18-33(27,28)4/h5-8,22,24-29H,9-21H2,1-4H3,(H,34,35) |
| InChIKey | NNCAEHLSEIQGNG-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|