About 4,5-bis(ethenyl)-1,3-diazinane
4,5-bis(ethenyl)-1,3-diazinane (PubChem CID 142845496) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-1,3-diazinane.
Molecular Properties
| Compound Name | 4,5-bis(ethenyl)-1,3-diazinane |
| PubChem CID | 142845496 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 4,5-bis(ethenyl)-1,3-diazinane |
| SMILES | C=CC1CNCNC1C=C |
| InChI | InChI=1S/C8H14N2/c1-3-7-5-9-6-10-8(7)4-2/h3-4,7-10H,1-2,5-6H2 |
| InChIKey | NLQGXQYKXUMZBX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-bis(ethenyl)-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(ethenyl)-1,3-diazinane?
The IUPAC name of 4,5-bis(ethenyl)-1,3-diazinane (CID 142845496) is 4,5-bis(ethenyl)-1,3-diazinane.
What is the SMILES notation for 4,5-bis(ethenyl)-1,3-diazinane?
The canonical SMILES for 4,5-bis(ethenyl)-1,3-diazinane is C=CC1CNCNC1C=C.
What is the InChIKey of 4,5-bis(ethenyl)-1,3-diazinane?
The InChIKey is NLQGXQYKXUMZBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-3-7-5-9-6-10-8(7)4-2/h3-4,7-10H,1-2,5-6H2.
What are the key properties of 4,5-bis(ethenyl)-1,3-diazinane?
4,5-bis(ethenyl)-1,3-diazinane has a molecular weight of 138.21 g/mol, XLogP of 0.49, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(ethenyl)-1,3-diazinane is sourced from PubChem (CID 142845496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).