About (2Z,5E)-6-fluoroocta-2,5-diene
(2Z,5E)-6-fluoroocta-2,5-diene (PubChem CID 142845543) has the molecular formula C8H13F
and a molecular weight of 128.19 g/mol. Its IUPAC name is (2Z,5E)-6-fluoroocta-2,5-diene.
Molecular Properties
| Compound Name | (2Z,5E)-6-fluoroocta-2,5-diene |
| PubChem CID | 142845543 |
| Molecular Formula | C8H13F |
| Molecular Weight | 128.19 g/mol |
| Exact Mass | 128.10 |
| IUPAC Name | (2Z,5E)-6-fluoroocta-2,5-diene |
| SMILES | C/C=C\C/C=C(/F)CC |
| InChI | InChI=1S/C8H13F/c1-3-5-6-7-8(9)4-2/h3,5,7H,4,6H2,1-2H3/b5-3-,8-7+ |
| InChIKey | VXGWGEVCNKMFLU-ZIQCHISCSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.19 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,5E)-6-fluoroocta-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,5E)-6-fluoroocta-2,5-diene?
The IUPAC name of (2Z,5E)-6-fluoroocta-2,5-diene (CID 142845543) is (2Z,5E)-6-fluoroocta-2,5-diene.
What is the SMILES notation for (2Z,5E)-6-fluoroocta-2,5-diene?
The canonical SMILES for (2Z,5E)-6-fluoroocta-2,5-diene is C/C=C\C/C=C(/F)CC.
What is the InChIKey of (2Z,5E)-6-fluoroocta-2,5-diene?
The InChIKey is VXGWGEVCNKMFLU-ZIQCHISCSA-N. The full InChI is InChI=1S/C8H13F/c1-3-5-6-7-8(9)4-2/h3,5,7H,4,6H2,1-2H3/b5-3-,8-7+.
What are the key properties of (2Z,5E)-6-fluoroocta-2,5-diene?
(2Z,5E)-6-fluoroocta-2,5-diene has a molecular weight of 128.19 g/mol, XLogP of 3.22, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,5E)-6-fluoroocta-2,5-diene is sourced from PubChem (CID 142845543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).