About 2,2-dimethyl-5-methylidene-1,3-dioxane-4,6-dione;ethane
2,2-dimethyl-5-methylidene-1,3-dioxane-4,6-dione;ethane (PubChem CID 142845575) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is 2,2-dimethyl-5-methylidene-1,3-dioxane-4,6-dione;ethane.
Molecular Properties
| Compound Name | 2,2-dimethyl-5-methylidene-1,3-dioxane-4,6-dione;ethane |
| PubChem CID | 142845575 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 2,2-dimethyl-5-methylidene-1,3-dioxane-4,6-dione;ethane |
| SMILES | C=C1C(=O)OC(C)(C)OC1=O.CC |
| InChI | InChI=1S/C7H8O4.C2H6/c1-4-5(8)10-7(2,3)11-6(4)9;1-2/h1H2,2-3H3;1-2H3 |
| InChIKey | SMCSYVWUTLKOEL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-5-methylidene-1,3-dioxane-4,6-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-5-methylidene-1,3-dioxane-4,6-dione;ethane?
The IUPAC name of 2,2-dimethyl-5-methylidene-1,3-dioxane-4,6-dione;ethane (CID 142845575) is 2,2-dimethyl-5-methylidene-1,3-dioxane-4,6-dione;ethane.
What is the SMILES notation for 2,2-dimethyl-5-methylidene-1,3-dioxane-4,6-dione;ethane?
The canonical SMILES for 2,2-dimethyl-5-methylidene-1,3-dioxane-4,6-dione;ethane is C=C1C(=O)OC(C)(C)OC1=O.CC.
What is the InChIKey of 2,2-dimethyl-5-methylidene-1,3-dioxane-4,6-dione;ethane?
The InChIKey is SMCSYVWUTLKOEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4.C2H6/c1-4-5(8)10-7(2,3)11-6(4)9;1-2/h1H2,2-3H3;1-2H3.
What are the key properties of 2,2-dimethyl-5-methylidene-1,3-dioxane-4,6-dione;ethane?
2,2-dimethyl-5-methylidene-1,3-dioxane-4,6-dione;ethane has a molecular weight of 186.21 g/mol, XLogP of 1.40, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-5-methylidene-1,3-dioxane-4,6-dione;ethane is sourced from PubChem (CID 142845575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).