C21H24N4O3 — CID 142845617
4-[4,6-bis(4-methoxyphenyl)-1,4-dihydro-1,3,5-triazin-2-yl]morpholine (PubChem CID 142845617) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 4-[4,6-bis(4-methoxyphenyl)-1,4-dihydro-1,3,5-triazin-2-yl]morpholine.
| Compound Name | 4-[4,6-bis(4-methoxyphenyl)-1,4-dihydro-1,3,5-triazin-2-yl]morpholine |
|---|---|
| PubChem CID | 142845617 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 4-[4,6-bis(4-methoxyphenyl)-1,4-dihydro-1,3,5-triazin-2-yl]morpholine |
| SMILES | COc1ccc(C2=NC(c3ccc(OC)cc3)N=C(N3CCOCC3)N2)cc1 |
| InChI | InChI=1S/C21H24N4O3/c1-26-17-7-3-15(4-8-17)19-22-20(16-5-9-18(27-2)10-6-16)24-21(23-19)25-11-13-28-14-12-25/h3-10,19H,11-14H2,1-2H3,(H,22,23,24) |
| InChIKey | KJUKEDQNJCWEBQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |