About ethane;3-methyl-5-phenyl-1,2-thiazole
ethane;3-methyl-5-phenyl-1,2-thiazole (PubChem CID 142845689) has the molecular formula C12H15NS
and a molecular weight of 205.33 g/mol. Its IUPAC name is ethane;3-methyl-5-phenyl-1,2-thiazole.
Molecular Properties
| Compound Name | ethane;3-methyl-5-phenyl-1,2-thiazole |
| PubChem CID | 142845689 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | ethane;3-methyl-5-phenyl-1,2-thiazole |
| SMILES | CC.Cc1cc(-c2ccccc2)sn1 |
| InChI | InChI=1S/C10H9NS.C2H6/c1-8-7-10(12-11-8)9-5-3-2-4-6-9;1-2/h2-7H,1H3;1-2H3 |
| InChIKey | NMEMOZRFSYMOTP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-methyl-5-phenyl-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-5-phenyl-1,2-thiazole?
The IUPAC name of ethane;3-methyl-5-phenyl-1,2-thiazole (CID 142845689) is ethane;3-methyl-5-phenyl-1,2-thiazole.
What is the SMILES notation for ethane;3-methyl-5-phenyl-1,2-thiazole?
The canonical SMILES for ethane;3-methyl-5-phenyl-1,2-thiazole is CC.Cc1cc(-c2ccccc2)sn1.
What is the InChIKey of ethane;3-methyl-5-phenyl-1,2-thiazole?
The InChIKey is NMEMOZRFSYMOTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NS.C2H6/c1-8-7-10(12-11-8)9-5-3-2-4-6-9;1-2/h2-7H,1H3;1-2H3.
What are the key properties of ethane;3-methyl-5-phenyl-1,2-thiazole?
ethane;3-methyl-5-phenyl-1,2-thiazole has a molecular weight of 205.33 g/mol, XLogP of 4.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-5-phenyl-1,2-thiazole is sourced from PubChem (CID 142845689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).