C25H27F5O4S — CID 142845770
propan-2-yl 4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfinyloxane-4-carboxylate (PubChem CID 142845770) has the molecular formula C25H27F5O4S and a molecular weight of 518.54 g/mol. Its IUPAC name is propan-2-yl 4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfinyloxane-4-carboxylate.
| Compound Name | propan-2-yl 4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfinyloxane-4-carboxylate |
|---|---|
| PubChem CID | 142845770 |
| Molecular Formula | C25H27F5O4S |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | propan-2-yl 4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfinyloxane-4-carboxylate |
| SMILES | CC(C)OC(=O)C1(S(=O)c2ccc(-c3ccc(CCC(F)(F)C(F)(F)F)cc3)cc2)CCOCC1 |
| InChI | InChI=1S/C25H27F5O4S/c1-17(2)34-22(31)23(13-15-33-16-14-23)35(32)21-9-7-20(8-10-21)19-5-3-18(4-6-19)11-12-24(26,27)25(28,29)30/h3-10,17H,11-16H2,1-2H3 |
| InChIKey | IVORXUKFUQHEAR-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|